CymitQuimica logo

CAS 5345-05-1

:

2-bromo-5-tert-butyl-1,3-dimethylbenzene

Description:
2-Bromo-5-tert-butyl-1,3-dimethylbenzene, with the CAS number 5345-05-1, is an organic compound belonging to the class of brominated aromatic hydrocarbons. It features a benzene ring substituted with a bromine atom, a tert-butyl group, and two methyl groups, which contribute to its unique chemical properties. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. The tert-butyl group provides steric hindrance, influencing the compound's reactivity and solubility. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. Its physical properties, such as boiling point and melting point, are influenced by the bulky tert-butyl group and the overall molecular structure. As with many brominated compounds, it is important to handle 2-bromo-5-tert-butyl-1,3-dimethylbenzene with care due to potential environmental and health impacts associated with brominated organic compounds.
Formula:C12H17Br
InChI:InChI=1/C12H17Br/c1-8-6-10(12(3,4)5)7-9(2)11(8)13/h6-7H,1-5H3
InChI key:HAIGIJCTBFVMEP-UHFFFAOYSA-N
SMILES:Cc1cc(cc(C)c1Br)C(C)(C)C
Synonyms:
  • Benzene, 2-Bromo-5-(1,1-Dimethylethyl)-1,3-Dimethyl-
  • 2-Bromo-5-tert-butyl-1,3-dimethylbenzene
Found 5 products.