CymitQuimica logo

CAS 5345-09-5

:

3,5-dimethyl-2-nitrophenol

Description:
3,5-Dimethyl-2-nitrophenol is an organic compound characterized by its aromatic structure, featuring a phenolic group with two methyl groups and a nitro group attached to the benzene ring. The presence of the nitro group introduces significant polarity, affecting its solubility and reactivity. This compound typically appears as a yellow crystalline solid and is known for its moderate to low solubility in water, while being more soluble in organic solvents. It exhibits acidic properties due to the hydroxyl group, allowing it to participate in various chemical reactions, including electrophilic substitution and nucleophilic attacks. 3,5-Dimethyl-2-nitrophenol is often used in research and industrial applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Safety considerations are important, as it may pose health risks upon exposure, necessitating proper handling and storage protocols. Overall, its unique structural features contribute to its utility in various chemical processes and applications.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-5-3-6(2)8(9(11)12)7(10)4-5/h3-4,10H,1-2H3
SMILES:Cc1cc(C)c(c(c1)O)N(=O)=O
Synonyms:
  • Phenol, 3,5-dimethyl-2-nitro-
  • 3,5-Dimethyl-2-nitrophenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.