CAS 5345-73-3
:2,2-Dichloro-N-methylacetamide
Description:
2,2-Dichloro-N-methylacetamide is an organic compound characterized by its structure, which includes two chlorine atoms attached to the second carbon of the acetamide group and a methyl group on the nitrogen atom. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical applications. The presence of chlorine atoms contributes to its reactivity, making it useful in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, 2,2-Dichloro-N-methylacetamide may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its chemical properties include the ability to participate in nucleophilic substitution reactions, and it may act as a reagent in the synthesis of other organic compounds. As with many chlorinated compounds, environmental considerations regarding its degradation and potential bioaccumulation are important in assessing its overall impact.
Formula:C3H5Cl2NO
InChI:InChI=1S/C3H5Cl2NO/c1-6-3(7)2(4)5/h2H,1H3,(H,6,7)
InChI key:InChIKey=BLQDAFLFPNDCMJ-UHFFFAOYSA-N
SMILES:C(C(Cl)Cl)(NC)=O
Synonyms:- Acetamide, 2,2-dichloro-N-methyl-
- Ai3-32125
- Dichloro-N-methylacetamide
- N-Methyl-2,2-dichloroacetamide
- N-Methyl-α,α-dichloroacetamide
- N-Methyldichloroacetamide
- NSC 1727
- 2,2-Dichloro-N-methylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
