CAS 5345-89-1
:3-(2,6-Dichlorophenyl)-2-propenoic acid
Description:
3-(2,6-Dichlorophenyl)-2-propenoic acid, also known as dichlorophenyl acrylic acid, is an organic compound characterized by its propenoic acid structure with a dichlorophenyl substituent. This compound typically appears as a solid or viscous liquid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the dichlorophenyl group contributes to its unique chemical properties, such as increased lipophilicity and potential biological activity. It is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic characteristics. The compound may participate in various chemical reactions, including esterification and polymerization, making it useful in the synthesis of more complex molecules. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and disposal methods are essential to mitigate risks associated with its use.
Formula:C9H6Cl2O2
InChI:InChI=1S/C9H6Cl2O2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)
InChI key:InChIKey=OIPVGRCXMFBNAN-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=C(Cl)C=CC=C1Cl
Synonyms:- (2E)-3-(2,6-dichlorophenyl)prop-2-enoate
- (2E)-3-(2,6-dichlorophenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-(2,6-dichlorophenyl)-
- 3,4-dihydroisoquinolin-2(1H)-yl(thiophen-2-yl)methanone
- 3-(2,6-Dichlorophenyl)-2-propenoic acid
- Cinnamic acid, 2,6-dichloro-
- Cinnamic acid, 2,6-dichloro- (6CI,7CI)
- Nsc 1762
- 2,6-Dichlorocinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,6-Dichlorocinnamic Acid
CAS:Formula:C9H6Cl2O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:217.052,6-Dichlorocinnamic acid
CAS:Formula:C9H6Cl2O2Purity:95%Color and Shape:SolidMolecular weight:217.04872,6-Dichlorocinnamic Acid, predominantly trans
CAS:2,6-Dichlorocinnamic Acid, predominantly transFormula:C9H6Cl2O2Purity:98%Molecular weight:217.048742,6-Dichlorocinnamic acid
CAS:2,6-Dichlorocinnamic acid is an organic compound that is used as a reagent in the synthesis of other chemicals. 2,6-Dichlorocinnamic acid has been used as a component in the synthesis of various kinds of fine chemicals and useful building blocks. This chemical is also used as a speciality chemical and research chemical. 2,6-Dichlorocinnamic acid can be used as a versatile building block for the preparation of various compounds. It can be synthesized by heating cinnamic acid with chlorine gas and then reacting it with sodium hydroxide.
Formula:C9H6Cl2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:217.05 g/mol



