CAS 53454-43-6
:2,3-Dihydro-1,5-benzothiazepin-4(5H)-one
Description:
2,3-Dihydro-1,5-benzothiazepin-4(5H)-one, with the CAS number 53454-43-6, is a heterocyclic compound that features a benzothiazepine core structure. This compound is characterized by its fused benzene and thiazepine rings, which contribute to its unique chemical properties. It typically exhibits a solid state at room temperature and is soluble in various organic solvents, although its solubility in water is limited. The presence of the carbonyl group (ketone) in its structure can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. Additionally, compounds of this class may exhibit biological activity, which has led to interest in their potential pharmaceutical applications. The molecular structure allows for various substitutions, which can further modify its properties and reactivity. Overall, 2,3-Dihydro-1,5-benzothiazepin-4(5H)-one represents a versatile scaffold in medicinal chemistry and organic synthesis.
Formula:C9H9NOS
InChI:InChI=1S/C9H9NOS/c11-9-5-6-12-8-4-2-1-3-7(8)10-9/h1-4H,5-6H2,(H,10,11)
InChI key:InChIKey=VNUDPFLTWOKTKQ-UHFFFAOYSA-N
SMILES:O=C1NC=2C(SCC1)=CC=CC2
Synonyms:- 1,5-benzothiazepin-4(5H)-one, 2,3-dihydro-
- 2,3,4,5-Tetrahydro-1,5-benzothiazepin-4-one
- 2,3-Dihydro-5H-benzo[b][1,4]thiazepin-4-one
- 2,3-Dihydrobenzo[b][1,4]thiazepin-4(5H)-one
- 3,5-Dihydro-2H-1,5-benzothiazepin-4-one
- 4-Oxo-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepine
- NSC 75690
- 2,3-Dihydro-1,5-benzothiazepin-4(5H)-one
- 2,3-Dihydro-1,5-benzothiazepin-4(5H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,3,4,5-Tetrahydro-1,5-benzothiazepin-4-one
CAS:Formula:C9H9NOSColor and Shape:SolidMolecular weight:179.23892,3-dihydro-1,5-benzothiazepin-4(5H)-one
CAS:Formula:C9H9NOSPurity:95.0%Color and Shape:No data available.Molecular weight:179.243,5-dihydro-2H-1,5-benzothiazepin-4-one
CAS:Controlled ProductApplications 3,5-dihydro-2H-1,5-benzothiazepin-4-one (cas# 53454-43-6) is a useful research chemical.
Formula:C9H9NOSColor and Shape:NeatMolecular weight:179.242,3,4,5-Tetrahydro-1,5-benzothiazepin-4-one
CAS:2,3,4,5-Tetrahydro-1,5-benzothiazepin-4-one is an organic compound that is used in the synthesis of pharmaceuticals. It is a ketone that has been shown to be active against some alkali metal ions such as potassium and sodium. 2,3,4,5-Tetrahydro-1,5-benzothiazepin-4-one reacts with an ethyl acetate solution of potassium carbonate to give a precipitate. The reaction proceeds through an acylation reaction between the ethyl acetate and potassium carbonate. This reaction is catalyzed by hydrogen bonds between 2,3,4,5-tetrahydro-1,5 benzothiazepin-4 one and the ethyl acetate molecule. This compound also reacts with esters to form ester derivatives. It has been shown to have an optically active form when dissolved in diethFormula:C9H9NOSPurity:Min. 95%Molecular weight:179.24 g/mol




