CAS 5346-69-0
:2-[(acetyloxy)methyl]-6-[(4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.0~2,6~]undec-7-yl)oxy]tetrahydro-2H-pyran-3,4,5-triyl triacetate (non-preferred name)
Description:
The chemical substance known as 2-[(acetyloxy)methyl]-6-[(4,4-dimethyl-3,5,10,11-tetraoxatricyclo[6.2.1.0~2,6~]undec-7-yl)oxy]tetrahydro-2H-pyran-3,4,5-triyl triacetate, with the CAS number 5346-69-0, is a complex organic compound characterized by its intricate molecular structure. It features a tetrahydropyran ring, which is a six-membered cyclic ether, and multiple acetate groups that contribute to its reactivity and solubility. The presence of a dimethyl-substituted tricyclic moiety adds to its structural complexity, potentially influencing its biological activity and interaction with other molecules. This compound may exhibit properties typical of acetates, such as being a good solvent or having specific reactivity in organic synthesis. Its unique structure suggests potential applications in pharmaceuticals or as a chemical intermediate, although specific biological or chemical properties would require further investigation. Overall, this compound exemplifies the diversity of organic chemistry and the potential for complex molecules to serve various functions in chemical and biological systems.
Formula:C23H32O14
InChI:InChI=1/C23H32O14/c1-9(24)28-7-13-15(30-10(2)25)17(31-11(3)26)19(32-12(4)27)22(34-13)35-16-14-8-29-21(33-14)20-18(16)36-23(5,6)37-20/h13-22H,7-8H2,1-6H3
SMILES:CC(=O)OCC1C(C(C(C(O1)OC1C2COC(C3C1OC(C)(C)O3)O2)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:- 4-O--(2,3,4,6-Tetra-O-acetyl-D-galactopyranosyl)-(1’,6’-anhydro-2’,3’-O-isopropylidene--D-mannopyranose)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-O-b-(2,3,4,6-Tetra-O-acetyl-D-galactopyranosyl)-1,6-anhydro-2,3-O-isopropylidene-b-D-mannopyranose
CAS:4-O-b-(2,3,4,6-Tetra-O-acetyl-D-galactopyranosyl)-1,6-anhydro-2,3-O-isopropylidene-b-D-mannopyranose is a custom synthesis of a monosaccharide. This monosaccharide is synthesized by the fluorination and methylation of 4,6 anhydro b D mannose followed by the click modification of the hydroxyl groups. The chemical name for this monosaccharide is 1,6 anhydro 2,3 O isopropylidene b D mannopyranose. It has a molecular weight of 390. The CAS number for this monosaccharide is 5346 69 0. 4,6 anhydro b D mannose is found in polysaccharides such as glycosaminoglycansFormula:C23H32O14Purity:Min. 95%Molecular weight:532.49 g/mol
