CAS 53462-88-7

Methyl 3-formyl-1H-indole-4-carboxylate

Description:

Methyl 3-formyl-1H-indole-4-carboxylate, with the CAS number 53462-88-7, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a formyl group (-CHO) and a carboxylate group (-COOCH3) attached to the indole framework, which contributes to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents such as ethanol and dichloromethane. The presence of functional groups allows for various chemical transformations, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, compounds like this one can exhibit biological activity, including antimicrobial or anticancer properties, although specific biological data would require further investigation. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.

Formula: C₁₁H₉NO₃

InChI: InChI=1/C11H9NO3/c1-15-11(14)8-3-2-4-9-10(8)7(6-13)5-12-9/h2-6,12H,1H3

SMILES: COC(=O)c1cccc2c1c(c[nH]2)C=O

Synonyms:

• 3-Formyl-1H-indole-4-carboxylic acid methyl ester
• Methyl 3-carboxaldehyde-4-carboxylate
• Methyl-3-Formylindole-4-carboxylate

3-formyl-1H-Indole-4-carboxylic acid methyl ester

CAS: 53462-88-7

Formula: C₁₁H₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.1941

Ref: IN-DA00D961

Methyl 3-formyl-1H-indole-4-carboxylate

CAS: 53462-88-7

Methyl 3-formyl-1H-indole-4-carboxylate

Purity: 97%

Color and Shape: Solid

Molecular weight: 203.19g/mol

Ref: 54-OR60220

Methyl 3-formyl-1H-indole-4-carboxylate

CAS: 53462-88-7

Formula: C₁₁H₉NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 203.197

Ref: 10-F214939