
CAS 5347-82-0
:N-(Methylsulfonyl)methanesulfonamide
Description:
N-(Methylsulfonyl)methanesulfonamide, with the CAS number 5347-82-0, is an organic compound characterized by its sulfonamide functional groups. It features a methylsulfonyl group attached to a methanesulfonamide backbone, which contributes to its unique chemical properties. This compound is typically a white crystalline solid and is soluble in polar solvents such as water and methanol, owing to the presence of sulfonamide groups that can engage in hydrogen bonding. It exhibits moderate stability under standard conditions but may be sensitive to strong acids or bases. N-(Methylsulfonyl)methanesulfonamide is of interest in various fields, including medicinal chemistry, due to its potential biological activities, particularly as a sulfonamide antibiotic or in the development of pharmaceuticals. Its structural characteristics allow for interactions with biological targets, making it a subject of research in drug design and development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C2H7NO4S2
InChI:InChI=1S/C2H7NO4S2/c1-8(4,5)3-9(2,6)7/h3H,1-2H3
InChI key:InChIKey=ICTGBOFCIDHVPA-UHFFFAOYSA-N
SMILES:N(S(C)(=O)=O)S(C)(=O)=O
Synonyms:- N-(Methylsulfonyl)methanesulfonamide
- Bis(methylsulfonyl)amide
- Dimesylamine
- Methanesulfonamide, N-(methylsulfonyl)-
- Dimethanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-(Methylsulfonyl)methanesulfonamide
CAS:Controlled ProductFormula:C2H7NO4S2Color and Shape:NeatMolecular weight:173.211

