CAS 5348-75-4
:(biphenyl-2-yloxy)acetic acid
Description:
Biphenyl-2-yloxy)acetic acid, with the CAS number 5348-75-4, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond, and an acetic acid functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively low reactivity under standard conditions. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water due to its hydrophobic biphenyl moiety. The presence of the acetic acid group imparts some polar characteristics, which can influence its interactions in biological systems or chemical reactions. This compound may be of interest in various applications, including pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and potential hazards, as with any chemical substance. Overall, biphenyl-2-yloxy)acetic acid represents a unique combination of structural features that may confer specific functional properties in chemical applications.
Formula:C14H12O3
InChI:InChI=1/C14H12O3/c15-14(16)10-17-13-9-5-4-8-12(13)11-6-2-1-3-7-11/h1-9H,10H2,(H,15,16)
SMILES:c1ccc(cc1)c1ccccc1OCC(=O)O
Synonyms:- Acetic Acid, 2-([1,1'-Biphenyl]-2-Yloxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(Biphenyl-2-yloxy)-acetic acid
CAS:Formula:C14H12O3Purity:97%Color and Shape:SolidMolecular weight:228.24332-([1,1'-Biphenyl]-2-yloxy)acetic acid
CAS:2-([1,1'-Biphenyl]-2-yloxy)acetic acidPurity:98%Molecular weight:228.24g/mol2-(2-Phenylphenoxy)acetic Acid
CAS:Controlled ProductFormula:C14H12O3Color and Shape:NeatMolecular weight:228.2432-([1,1'-Biphenyl]-2-yloxy)acetic acid
CAS:2-([1,1'-Biphenyl]-2-yloxy)acetic acid is a white solid that has a melting point of 9 °C and a boiling point of 244 °C. It is soluble in water, ethanol, and acetone. This compound can be used as an organic solvent and is used to synthesize sodium carbonate. 2-([1,1'-Biphenyl]-2-yloxy)acetic acid is also used as a recrystallizing agent for industrial purposes. The synthesis method for this compound includes the use of catalysts such as carbonates and trifluoroacetic anhydride. The substance has been shown to cause pollution in the environment due to its high reactivity with oxygen.Formula:C14H12O3Purity:Min. 95%Molecular weight:228.25 g/mol




