CAS 53484-26-7

4-bromo-N-methyl-2-nitroaniline

Description:

4-Bromo-N-methyl-2-nitroaniline is an organic compound characterized by its aromatic structure, which includes a bromine atom, a nitro group, and a methylamino group attached to a benzene ring. The presence of the bromine atom at the para position relative to the amino group and the nitro group at the ortho position contributes to its unique reactivity and properties. This compound typically appears as a solid and is soluble in organic solvents, while its solubility in water is limited. It is often used in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. The nitro group is a strong electron-withdrawing group, which influences the compound's reactivity, making it a potential candidate for electrophilic substitution reactions. Additionally, the presence of the methyl group enhances the compound's nucleophilicity. Safety precautions should be taken when handling this substance, as it may pose health risks, including potential toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate these risks.

Formula: C₇H₇BrN₂O₂

InChI: InChI=1/C7H7BrN2O2/c1-9-6-3-2-5(8)4-7(6)10(11)12/h2-4,9H,1H3

SMILES: CNc1ccc(cc1N(=O)=O)Br

4-Bromo-N-methyl-2-nitroaniline

CAS: 53484-26-7

Formula: C₇H₇BrN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 231.0467

Ref: IN-DA00DHYR

4-Bromo-N-methyl-2-nitroaniline

CAS: 53484-26-7

4-Bromo-N-methyl-2-nitroaniline

Purity: 97%

Molecular weight: 231.05g/mol

Ref: 54-OR90362

4-Bromo-N-methyl-2-nitroaniline

CAS: 53484-26-7

Formula: C₇H₇BrN₂O₂

Purity: 95%

Color and Shape: No data available.

Molecular weight: 231.049

Ref: 10-F211459

4-Bromo-N-methyl-2-nitroaniline

CAS: 53484-26-7

Versatile small molecule scaffold

Formula: C₇H₇BrN₂O₂

Purity: Min. 95%

Molecular weight: 231.05 g/mol

Ref: 3D-DCA48426