CAS 5349-18-8
:1-(benzylsulfinyl)-3-phenoxypropan-2-ol
Description:
1-(Benzylsulfinyl)-3-phenoxypropan-2-ol, with the CAS number 5349-18-8, is a chemical compound characterized by its unique structural features, including a benzylsulfinyl group and a phenoxy group attached to a propanol backbone. This compound typically exhibits properties associated with both alcohols and sulfoxides, such as moderate polarity and the ability to participate in hydrogen bonding due to the hydroxyl (-OH) group. The presence of the phenoxy group may contribute to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. Additionally, the sulfinyl moiety can enhance the compound's reactivity and stability, making it of interest in medicinal chemistry and pharmaceutical applications. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C16H18O3S
InChI:InChI=1/C16H18O3S/c17-15(11-19-16-9-5-2-6-10-16)13-20(18)12-14-7-3-1-4-8-14/h1-10,15,17H,11-13H2
SMILES:c1ccc(cc1)CS(=O)CC(COc1ccccc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
