CAS 5349-78-0
:4,8-dimethylquinolin-2(1H)-one
Description:
4,8-Dimethylquinolin-2(1H)-one, with the CAS number 5349-78-0, is a heterocyclic organic compound belonging to the quinoline family. This compound features a quinoline backbone, which consists of a fused benzene and pyridine ring, and is substituted at the 4 and 8 positions with methyl groups, as well as a carbonyl group at the 2 position, contributing to its classification as a quinolinone. It typically appears as a solid at room temperature and is characterized by its aromatic nature, which imparts stability and unique chemical reactivity. The presence of the carbonyl group allows for potential interactions in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility can vary depending on the solvent, and it may be used in various applications, including as a building block in organic synthesis or as a potential pharmaceutical agent. Safety data should be consulted for handling and usage guidelines.
Formula:C11H11NO
InChI:InChI=1/C11H11NO/c1-7-4-3-5-9-8(2)6-10(13)12-11(7)9/h3-6H,1-2H3,(H,12,13)
SMILES:Cc1cccc2c(C)cc(nc12)O
Synonyms:- 2(1H)-quinolinone, 4,8-dimethyl-
- 2-Quinolinol, 4,8-Dimethyl-
- 4,8-Dimethylquinolin-2-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
