CAS 5349-99-5
:Triethyl aconitate
Description:
Triethyl aconitate, with the CAS number 5349-99-5, is an organic compound that belongs to the class of esters. It is derived from aconitic acid and is characterized by its three ethyl groups attached to the aconitate backbone. This compound typically appears as a colorless to pale yellow liquid with a fruity odor. Triethyl aconitate is known for its solubility in organic solvents, making it useful in various applications, including as a flavoring agent and in the synthesis of other chemical compounds. Its chemical structure features multiple functional groups, which contribute to its reactivity and potential uses in organic synthesis. Additionally, triethyl aconitate may exhibit properties such as low volatility and moderate stability under standard conditions. As with many esters, it can undergo hydrolysis in the presence of water, reverting to its parent acid and alcohol. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C12H18O6
InChI:InChI=1S/C12H18O6/c1-4-16-10(13)7-9(12(15)18-6-3)8-11(14)17-5-2/h7H,4-6,8H2,1-3H3
InChI key:InChIKey=IDDWGDKSBYYEPL-UHFFFAOYSA-N
SMILES:C(CC(OCC)=O)(=CC(OCC)=O)C(OCC)=O
Synonyms:- 1-Propene-1,2,3-tricarboxylic acid, 1,2,3-triethyl ester
- 1-Propene-1,2,3-tricarboxylic acid, triethyl ester
- Aconitic acid, triethyl ester
- Ai3-11238
- Ethyl aconitate
- N-(2,5-dichlorophenyl)-4-fluorobenzenesulfonamide
- Triethyl Prop-1-Ene-1,2,3-Tricarboxylate
- Triethyl aconitate
- triethyl (1Z)-prop-1-ene-1,2,3-tricarboxylate
- Triethyl 1-propene-1,2,3-tricarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Triethyl aconitate
CAS:<p>Triethyl aconitate is a biochemical.</p>Formula:C12H18O6Color and Shape:SolidMolecular weight:258.27
