CAS 53498-60-5
:2-(2-methoxyphenoxy)-2-methylpropanoic acid
Description:
2-(2-Methoxyphenoxy)-2-methylpropanoic acid, identified by its CAS number 53498-60-5, is an organic compound characterized by its unique structure that includes a methoxyphenyl group and a branched propanoic acid moiety. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. It is likely to be a solid at room temperature, with moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic characteristics due to the aromatic ring. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may form salts or esters. Additionally, the methoxy group can influence the compound's reactivity and interaction with biological systems, potentially affecting its pharmacokinetic properties. Overall, 2-(2-methoxyphenoxy)-2-methylpropanoic acid is a compound of interest for its structural features and potential utility in various chemical applications.
Formula:C11H14O4
InChI:InChI=1/C11H14O4/c1-11(2,10(12)13)15-9-7-5-4-6-8(9)14-3/h4-7H,1-3H3,(H,12,13)
SMILES:CC(C)(C(=O)O)Oc1ccccc1OC
Synonyms:- Propanoic Acid, 2-(2-Methoxyphenoxy)-2-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Methoxyphenoxy)-2-methylpropanoic acid
CAS:2-(2-Methoxyphenoxy)-2-methylpropanoic acidPurity:96%Molecular weight:210.23g/mol2-(2-Methoxyphenoxy)-2-methylpropanoic acid
CAS:2-(2-Methoxyphenoxy)-2-methylpropanoic acid is a versatile building block that can be used as a reagent in organic synthesis. It is also an intermediate for the synthesis of various pharmaceuticals, including 2-methoxyestradiol and methoxymacroin. This compound is commercially available from chemical suppliers and can be used to synthesize other compounds with a variety of functional groups.Formula:C11H14O4Purity:Area-% Min. 95 Area-%Color and Shape:PowderMolecular weight:210.23 g/mol



