CAS 535-67-1
:5-amino-1,3-thiazole-2-carbothioamide
Description:
5-Amino-1,3-thiazole-2-carbothioamide is a heterocyclic compound characterized by the presence of both thiazole and amine functional groups. Its molecular structure features a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of the amino group (-NH2) enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The carbothioamide functional group (-C(S)NH2) indicates that the compound can participate in thiol-related chemistry, which is significant in biological systems and synthetic applications. This compound is often studied for its potential biological activities, including antimicrobial and antitumor properties. Additionally, its solubility in polar solvents and stability under standard laboratory conditions make it suitable for various synthetic and analytical applications. Overall, 5-amino-1,3-thiazole-2-carbothioamide is a versatile compound with implications in medicinal chemistry and organic synthesis.
Formula:C4H5N3S2
InChI:InChI=1/C4H5N3S2/c5-2-1-7-4(9-2)3(6)8/h1H,5H2,(H2,6,8)
SMILES:c1c(N)sc(C(=S)N)n1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
5-Amino-1,3-thiazole-2-carbothioamide
CAS:5-Amino-1,3-thiazole-2-carbothioamide (5ATC) is a liquid that is soluble in organic solvents. It has been used as a starting material for the synthesis of other compounds. 5ATC can be prepared by the reaction of ethyl acetoacetate with an acid chloride and a base such as pyridine. The reaction is heated to reflux for about 2 hours in an organic solvent, such as chloroform or benzene, followed by cooling to room temperature. It can also be prepared from an amide and hydrogen chloride gas in the presence of pyridine. This synthesis requires manual stirring at room temperature for 12 hours. 5ATC can be purified by recrystallization from water or ether.
Formula:C4H5N3S2Purity:Min. 95%Molecular weight:159.2 g/mol
