CAS 5350-50-5

7-chloro-3-nitroquinolin-4(1H)-one

Description:

7-Chloro-3-nitroquinolin-4(1H)-one is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 7-position and a nitro group at the 3-position contributes to its unique chemical properties. This compound typically appears as a yellow to orange solid and is known for its potential biological activity, including antimicrobial and antitumor properties. It is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and ethanol, but has limited solubility in water. The compound's reactivity can be attributed to the electron-withdrawing effects of the nitro and chloro substituents, which can influence its interaction with biological targets. Additionally, 7-chloro-3-nitroquinolin-4(1H)-one may serve as a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals, making it of interest in medicinal chemistry and drug development. Proper handling and safety precautions are essential due to its potential toxicity and environmental impact.

Formula: C₉H₅ClN₂O₃

InChI: InChI=1/C9H5ClN2O3/c10-5-1-2-6-7(3-5)11-4-8(9(6)13)12(14)15/h1-4H,(H,11,13)

SMILES: c1cc2c(cc1Cl)[nH]cc(c2=O)N(=O)=O

7-Chloro-3-nitroquinolin-4-ol

CAS: 5350-50-5

Formula: C₉H₅ClN₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 224.6006

Ref: IN-DA00D949

7-Chloro-3-nitroquinolin-4-ol

CAS: 5350-50-5

7-Chloro-3-nitroquinolin-4-ol

Purity: 96%

Molecular weight: 224.60g/mol

Ref: 54-OR90919

7-Chloro-4-hydroxy-3-nitroquinoline

CAS: 5350-50-5

Formula: C₉H₅ClN₂O₃

Purity: 96%

Color and Shape: Solid, No data available.

Molecular weight: 224.6

Ref: 10-F049129