CAS 5351-71-3
:2-[1-(2-Thienyl)ethylidene]hydrazinecarbothioamide
Description:
2-[1-(2-Thienyl)ethylidene]hydrazinecarbothioamide, with the CAS number 5351-71-3, is an organic compound characterized by its unique structural features, including a thienyl group and a hydrazinecarbothioamide moiety. This compound typically exhibits a thienyl ring, which contributes to its aromatic properties and potential reactivity. The presence of the hydrazine functional group suggests that it may participate in various chemical reactions, including condensation and substitution reactions. Additionally, the carbothioamide group indicates that it may exhibit thiol-like properties, potentially influencing its solubility and reactivity in biological systems. The compound may also display interesting biological activities, making it a subject of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2-[1-(2-Thienyl)ethylidene]hydrazinecarbothioamide represents a versatile structure with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H9N3S2
InChI:InChI=1S/C7H9N3S2/c1-5(9-10-7(8)11)6-3-2-4-12-6/h2-4H,1H3,(H3,8,10,11)
InChI key:InChIKey=PJVHAJJEMJNPHN-UHFFFAOYSA-N
SMILES:C(=NNC(N)=S)(C)C1=CC=CS1
Synonyms:- 2-[1-(2-Thienyl)ethylidene]hydrazinecarbothioamide
- NSC 707
- Ketone, methyl 2-thienyl, thiosemicarbazone
- 2-Acetylthiophene thiosemicarbazone
- Hydrazinecarbothioamide, 2-[1-(2-thienyl)ethylidene]-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Acetylthiophene thiosemicarbazone
CAS:2-Acetylthiophene thiosemicarbazone is an antimicrobial agent against a wide range of gram-negative and gram-positive bacteri and fungi.Formula:C7H9N3S2Color and Shape:SolidMolecular weight:199.3
