CAS 53515-20-1

4-(1-Methylethyl)benzenecarbothioamide

Description:

4-(1-Methylethyl)benzenecarbothioamide, also known by its CAS number 53515-20-1, is an organic compound characterized by the presence of a thiocarbonyl functional group (-C(=S)NHR) attached to a benzene ring that is further substituted with an isopropyl group. This compound typically exhibits properties associated with thioamides, including potential reactivity in nucleophilic substitution reactions due to the electrophilic nature of the carbon atom in the thiocarbonyl group. The presence of the isopropyl group contributes to its hydrophobic character, influencing its solubility in organic solvents rather than in water. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and agricultural applications. Its structural features suggest potential for interactions with various biological targets, which could be explored in further research. As with many thioamides, it may also participate in various chemical reactions, including condensation and cyclization, making it a versatile building block in organic synthesis.

Formula: C₁₀H₁₃NS

InChI: InChI=1S/C10H13NS/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3,(H2,11,12)

InChI key: InChIKey=SDNLXXUGUAWDAT-UHFFFAOYSA-N

SMILES: C(C)(C)C1=CC=C(C(N)=S)C=C1

Synonyms:

• 4-(1-Methylethyl)benzenecarbothioamide
• 4-Isopropylbenzenecarbothioamide
• 4-Isopropylthiobenzamide
• Benzenecarbothioamide, 4-(1-Methylethyl)-
• p-Isopropylthiobenzamide

4-Isopropylbenzothioamide

CAS: 53515-20-1

Formula: C₁₀H₁₃NS

Color and Shape: Solid

Molecular weight: 179.2819

Ref: IN-DA00DD5O

4-(Propan-2-yl)benzene-1-carbothioamide

CAS: 53515-20-1

4-(Propan-2-yl)benzene-1-carbothioamide

Purity: 95%

Molecular weight: 179.28g/mol

Ref: 54-OR33532

4-Isopropylbenzenecarbothioamide

CAS: 53515-20-1

4-Isopropylbenzenecarbothioamide is a versatile compound with various applications. It belongs to the class of epoxy, pyrazoles, acalabrutinib, eriosema tuberosum, broussonetia, amide, sulfonamide, pyrroles, monoterpenoid, ether, aluminum, quinazolines, aspergillus, piperazines and is considered a natural product. This compound has been extensively studied for its potential therapeutic properties and has shown promising results in various fields. Its unique chemical structure makes it suitable for use in different industries such as pharmaceuticals and agriculture. The diverse range of applications of 4-Isopropylbenzenecarbothioamide makes it an essential ingredient in many products.

Formula: C₁₀H₁₃NS

Purity: Min. 95%

Molecular weight: 179.28 g/mol

Ref: 3D-DCA51520