CAS 53516-94-2

4-methyl-3-nitrobenzenesulfonohydrazide

Description:

4-Methyl-3-nitrobenzenesulfonohydrazide is an organic compound characterized by its sulfonohydrazide functional group, which combines a hydrazine moiety with a sulfonic acid derivative. This compound features a methyl group and a nitro group on a benzene ring, contributing to its unique reactivity and properties. The presence of the nitro group typically enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The sulfonohydrazide structure can also impart solubility in polar solvents, which is advantageous for its application in synthesis and analysis. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 53516-94-2, allows for precise identification in chemical databases. Overall, 4-methyl-3-nitrobenzenesulfonohydrazide is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₇H₉N₃O₄S

InChI: InChI=1/C7H9N3O4S/c1-5-2-3-6(15(13,14)9-8)4-7(5)10(11)12/h2-4,9H,8H2,1H3

SMILES: Cc1ccc(cc1N(=O)=O)S(=O)(=O)NN

4-METHYL-3-NITROBENZENESULFONOHYDRAZIDE

CAS: 53516-94-2

Formula: C₇H₉N₃O₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 231.2291

Ref: IN-DA00DKLV

4-Methyl-3-nitrobenzenesulfonohydrazide

CAS: 53516-94-2

Versatile small molecule scaffold

Formula: C₇H₉N₃O₄S

Purity: Min. 95%

Molecular weight: 231.23 g/mol

Ref: 3D-DCA51694