CAS 5352-53-4

N,N'-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]biphenyl-4,4'-dicarboxamide

Description:

N,N'-bis[3-(4,5-dihydro-1H-imidazol-2-yl)phenyl]biphenyl-4,4'-dicarboxamide, identified by its CAS number 5352-53-4, is a synthetic organic compound characterized by its complex molecular structure, which includes biphenyl and imidazole moieties. This compound typically exhibits properties such as high thermal stability and solubility in organic solvents, making it suitable for various applications in materials science and organic electronics. Its imidazole groups may impart biological activity, potentially allowing for interactions with biological systems, which could be of interest in pharmaceutical research. The presence of carboxamide functional groups suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound's structural features may contribute to its electronic properties, making it a candidate for use in organic semiconductors or as a dye. Overall, the unique combination of functional groups and structural elements in this compound positions it as a versatile material in both chemical and biological contexts.

Formula: C₃₂H₂₈N₆O₂

InChI: InChI=1/C32H28N6O2/c39-31(37-27-5-1-3-25(19-27)29-33-15-16-34-29)23-11-7-21(8-12-23)22-9-13-24(14-10-22)32(40)38-28-6-2-4-26(20-28)30-35-17-18-36-30/h1-14,19-20H,15-18H2,(H,33,34)(H,35,36)(H,37,39)(H,38,40)

SMILES: c1cc(cc(c1)NC(=O)c1ccc(cc1)c1ccc(cc1)C(=O)Nc1cccc(c1)C1=NCCN1)C1=NCCN1

BPH-1358

CAS: 5352-53-4

BPH-1358

Purity: ≥98%

Molecular weight: 601.53g/mol

Ref: 54-BUP12065

BPH-1358

CAS: 5352-53-4

BPH-1358 is a novel synthetic inhibitor, which is derived from a series of advanced chemoinformatics-based design strategies. It functions through the targeted binding to specific cell surface receptors involved in the modulation of immune responses. By blocking these receptors, BPH-1358 effectively alters signaling pathways that are crucial for immune activation and inflammatory responses.

Formula: C₃₂H₂₈N₆O₂

Purity: Min. 95%

Molecular weight: 528.6 g/mol

Ref: 3D-FAA35253

BPH-1358

CAS: 5352-53-4

BPH-1358 (NSC-50460) inhibits FPPS and UPPS (IC50: 1.8 μM, 110 nM), active against S. aureus (MIC ~250 ng/mL).

Formula: C₃₂H₃₀Cl₂N₆O₂

Purity: 99.74%

Color and Shape: Solid

Molecular weight: 601.53

Ref: TM-T10586L