CAS 53524-27-9
:2-amino-4-chloro-5-methylphenol
Description:
2-Amino-4-chloro-5-methylphenol, with the CAS number 53524-27-9, is an organic compound characterized by the presence of an amino group (-NH2), a chloro substituent (-Cl), and a methyl group (-CH3) attached to a phenolic ring. This compound typically appears as a solid and is soluble in polar solvents due to the hydroxyl group inherent in phenols. It exhibits properties typical of phenolic compounds, such as being a weak acid and capable of forming hydrogen bonds. The presence of the amino group contributes to its basicity, while the chloro and methyl groups influence its reactivity and steric properties. This compound is often used in various applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as it may pose health risks if not handled properly.
Formula:C7H8ClNO
InChI:InChI=1/C7H8ClNO/c1-4-2-7(10)6(9)3-5(4)8/h2-3,10H,9H2,1H3
InChI key:InChIKey=QDGJHZNOQSIFAT-UHFFFAOYSA-N
SMILES:CC1=C(Cl)C=C(N)C(O)=C1
Synonyms:- 2-Hydroxy-5-chloro-4-methylaniline
- Phenol, 2-amino-4-chloro-5-methyl-
- 2-Amino-4-chloro-5-methylphenol
- 2-Amino-4-chloro-5-methylphenol
- 3-Methyl-4-chloro-6-aminophenol
- Einecs 258-606-8
- 2-AMINO-4-CHLORO-5-METHYL PHENOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
