CAS 53525-65-8

5H,10H-diimidazo[1,5-a:1',5'-d]pyrazine-5,10-dione

Description:

5H,10H-diimidazo[1,5-a:1',5'-d]pyrazine-5,10-dione, with the CAS number 53525-65-8, is a heterocyclic compound characterized by its unique bicyclic structure that incorporates imidazole and pyrazine moieties. This compound features two imidazole rings fused to a pyrazine ring, with carbonyl groups at the 5 and 10 positions, contributing to its diketone functionality. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. The presence of nitrogen atoms in its structure imparts basic properties, and it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. This compound is of interest in medicinal chemistry and materials science due to its potential biological activity and ability to form coordination complexes. Its solubility can vary, often being more soluble in polar solvents. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₈H₄N₄O₂

InChI: InChI=1/C8H4N4O2/c13-7-5-1-9-3-11(5)8(14)6-2-10-4-12(6)7/h1-4H

SMILES: c1c2c(=O)n3cncc3c(=O)n2cn1

Synonyms:

• 5H,10H-Diimidazo[1,5-a:1',5'-d]pyrazine-5,10-dione

5H,10H-Diimidazo[1,5-a:1',5'-d]pyrazine-5,10-dione

CAS: 53525-65-8

Formula: C₈H₄N₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.1430

Ref: IN-DA00D93L

Diimidazo[1,5-A:1',5'-D]Pyrazine-5,10-Dione

CAS: 53525-65-8

Diimidazo[1,5-A:1',5'-D]Pyrazine-5,10-Dione

Purity: 95%

Molecular weight: 188.14g/mol

Ref: 54-OR1027416