CAS 53526-66-2: methyl (1S,4aR,6S,7R,7aS)-1-(beta-D-glucopyranosyloxy)-4a,7-dihydroxy-6-{[(2E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy}-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate
Description:The chemical substance with the name "methyl (1S,4aR,6S,7R,7aS)-1-(beta-D-glucopyranosyloxy)-4a,7-dihydroxy-6-{[(2E)-3-(4-methoxyphenyl)prop-2-enoyl]oxy}-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate" and CAS number 53526-66-2 is a complex organic compound characterized by its intricate molecular structure, which includes multiple stereocenters and functional groups. It features a glucopyranosyl moiety, indicating it is a glycoside, and contains hydroxyl groups that contribute to its potential solubility in polar solvents. The presence of a methoxyphenyl group suggests possible aromatic interactions, which may influence its biological activity. Additionally, the hexahydrocyclopenta structure indicates a fused ring system, which can affect the compound's conformational flexibility and stability. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and natural product research. Its specific interactions and applications would depend on further studies, including its reactivity, bioavailability, and potential therapeutic effects.
Formula:C27H34O14
InChI:InChI=1/C27H34O14/c1-26(34)17(40-18(29)9-6-13-4-7-14(36-2)8-5-13)10-27(35)15(23(33)37-3)12-38-25(22(26)27)41-24-21(32)20(31)19(30)16(11-28)39-24/h4-9,12,16-17,19-22,24-25,28,30-32,34-35H,10-11H2,1-3H3/b9-6+/t16-,17+,19-,20+,21-,22-,24+,25+,26+,27+/m1/s1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Durantoside II REF: TM-TN3903CAS: 53526-66-2 | 98% | To inquire | Mon 28 Apr 25 |
![]() | Durantoside II REF: BP-SBP02329CAS: 53526-66-2 | 95%~99% | To inquire | Wed 30 Apr 25 |
![]() | Durantoside II REF: 3D-DCA52666CAS: 53526-66-2 | Min. 95% | 492.00 €~3,711.00 € | Tue 10 Jun 25 |

Durantoside II
Ref: TM-TN3903
5mg | 598.00 € | ||
1mL*10mM (DMSO) | 922.00 € |

Durantoside II
Ref: BP-SBP02329
Undefined size | To inquire |

Durantoside II
Ref: 3D-DCA52666
1mg | 492.00 € | ||
5mg | 1,270.00 € | ||
10mg | 1,980.00 € | ||
25mg | 3,711.00 € |