CAS 53526-67-3

Durantoside I

Description:

Durantoside I, with the CAS number 53526-67-3, is a natural glycoside primarily derived from the plant species of the genus Duranta. This compound is characterized by its complex structure, which typically includes a sugar moiety linked to a non-sugar aglycone. Durantoside I exhibits notable biological activities, including potential anti-inflammatory and antioxidant properties, making it of interest in pharmacological research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in various fields, including herbal medicine and nutraceuticals. Additionally, the compound's safety profile and efficacy are subjects of ongoing studies, as researchers explore its potential therapeutic uses. As with many natural products, the extraction and purification processes can significantly influence the yield and quality of Durantoside I, highlighting the importance of precise methodologies in its study and application.

Formula: C₂₆H₃₂O₁₃

InChI: InChI=1S/C26H32O13/c1-25(33)16(38-17(28)9-8-13-6-4-3-5-7-13)10-26(34)14(22(32)35-2)12-36-24(21(25)26)39-23-20(31)19(30)18(29)15(11-27)37-23/h3-9,12,15-16,18-21,23-24,27,29-31,33-34H,10-11H2,1-2H3/t15-,16+,18-,19+,20-,21-,23+,24+,25+,26+/m1/s1

InChI key: InChIKey=YRARGBWFOYODHQ-ISBSIBOYSA-N

SMILES: O[C@]12[C@]([C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C1C(OC)=O)([C@@](C)(O)[C@@H](OC(C=CC4=CC=CC=C4)=O)C2)[H]

Synonyms:

• Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a,7-dihydroxy-7-methyl-6-[(1-oxo-3-phenyl-2-propenyl)oxy]-, methyl ester, [1S-(1α,4aα,6α,7α,7aα)]-
• Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a,7-dihydroxy-7-methyl-6-[(1-oxo-3-phenyl-2-propen-1-yl)oxy]-, methyl ester, (1S,4aR,6S,7R,7aS)-
• Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,6,7,7a-hexahydro-4a,7-dihydroxy-7-methyl-6-[(1-oxo-3-phenyl-2-propenyl)oxy]-, methyl ester, (1S,4aR,6S,7R,7aS)-
• Durantoside I

Durantoside I

CAS: 53526-67-3

Durantoside I has inhibitory activity on the growth of lettuce seedling. It also displays DPPH scavenging activity.

Formula: C₂₆H₃₂O₁₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 552.529

Ref: TM-TN3902

Durantoside I

CAS: 53526-67-3

Formula: C₂₆H₃₂O₁₃

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 552.529

Ref: BP-SBP02328

Durantoside I

CAS: 53526-67-3

Durantoside I is an iridoid glycoside, a type of secondary metabolite that is naturally occurring in various plant species. It is primarily sourced from the **Duranta** genus, known for its rich content of unique bioactive compounds. The mode of action for iridoid glycosides typically involves interactions with specific enzymes and biological pathways, often leading to anti-inflammatory, antioxidant, and other pharmacological effects, though the exact mechanism can vary depending on the biological system in question.

Formula: C₂₆H₃₂O₁₃

Purity: Min. 95%

Molecular weight: 552.5 g/mol

Ref: 3D-DCA52667