CAS 53527-07-4

N-[2-(4-hydroxyphenyl)ethyl]-2-iodoacetamide

Description:

N-[2-(4-hydroxyphenyl)ethyl]-2-iodoacetamide, with the CAS number 53527-07-4, is a chemical compound characterized by its structural features that include an iodine atom and a hydroxyphenyl group. This compound typically exhibits properties associated with both amides and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the iodine atom, which can participate in nucleophilic substitution reactions. The hydroxy group contributes to its potential for hydrogen bonding, influencing its solubility and interaction with biological systems. Additionally, the presence of the aromatic ring may impart stability and influence the compound's electronic properties. This compound may be of interest in medicinal chemistry and pharmacology due to its structural motifs, which can be relevant in drug design and development. Its specific applications and biological activities would depend on further empirical studies and characterization.

Formula: C₁₀H₁₂INO₂

InChI: InChI=1/C10H12INO2/c11-7-10(14)12-6-5-8-1-3-9(13)4-2-8/h1-4,13H,5-7H2,(H,12,14)

SMILES: c1cc(ccc1CCN=C(CI)O)O

β-(4-Hydroxyphenyl)ethyl iodoacetamide

CAS: 53527-07-4

Formula: C₁₀H₁₂INO₂

Molecular weight: 305.1122

Ref: IN-DA00E3IN

N-Iodoacetyltyramine

Controlled Product

CAS: 53527-07-4

Applications N-Iodoacetyltyramine is used in iodine-125 labelling of various molecules for chemical analysis.
References Lin, C. et al.: Anal. Biochem., 179, 389 (1989);

Formula: C₁₀H₁₂INO₂

Color and Shape: Neat

Molecular weight: 305.11

Ref: TR-I685880

b-(4-Hydroxyphenyl)ethyl iodoacetamide

CAS: 53527-07-4

Formula: C₁₀H₁₂INO₂

Purity: 98.0%

Color and Shape: Liquid, No data available.

Molecular weight: 305.115

Ref: 10-F493857