CAS 5355-16-8: Diaveridine
Description:Diaveridine is a chemical compound classified as an antiviral agent, primarily used in the treatment of viral infections, particularly those caused by certain strains of the influenza virus. It is known for its ability to inhibit viral replication, making it a valuable therapeutic option in specific clinical settings. Diaveridine is characterized by its molecular structure, which includes a pyrimidine ring, contributing to its biological activity. The compound exhibits moderate solubility in water and is typically administered in a pharmaceutical formulation. Its mechanism of action involves interference with viral nucleic acid synthesis, thereby hindering the virus's ability to replicate within host cells. While it has shown efficacy in laboratory studies, the clinical use of diaveridine may be limited by factors such as resistance development and side effects. As with any antiviral medication, careful consideration of dosage and potential interactions with other drugs is essential for effective treatment. Overall, diaveridine represents a specific approach in antiviral therapy, highlighting the importance of ongoing research in the field of infectious diseases.
Formula:C13H16N4O2
InChI:InChI=1S/C13H16N4O2/c1-18-10-4-3-8(6-11(10)19-2)5-9-7-16-13(15)17-12(9)14/h3-4,6-7H,5H2,1-2H3,(H4,14,15,16,17)
InChI key:InChIKey=LDBTVAXGKYIFHO-UHFFFAOYSA-N
SMILES:N=1C=C(C(=NC1N)N)CC2=CC=C(OC)C(OC)=C2
- Synonyms:
- 2,4-Diamino-5-(3,4-Dimethoxy Benzyl)Pyrimidine
- 2,4-Diamino-5-(3,4-dimethoxybenzyl)pyrimidine
- 2,4-Diamino-5-Veratryl-Pyrimidin
- 2,4-Diamino-5-veratrylpyrimidine
- 2,4-Pyrimidinediamine, 5-[(3,4-dimethoxyphenyl)methyl]-
- 5-((3,4-Dimethoxyphenyl)Methyl)-4-Pyrimidinediamine
- 5-(3,4-Dimethoxy-Benzyl)-Pyrimidine-2,4-Diamine
- 5-(3,4-Dimethoxybenzyl)-2,4-Pyrimidinediamine
- 5-[(3,4-Dimethoxyphenyl)Methyl]-2,4-Pyrimidinediamine
- Bw 49-210
- See more synonyms
- Diaveridin
- Egis 5645
- NSC 408735
- Pyrimidine, 2,4-diamino-5-veratryl-
