CAS 53555-01-4
:4,5,6-Trichloro-2-(2,4-dichlorophenoxy)phenol
Description:
4,5,6-Trichloro-2-(2,4-dichlorophenoxy)phenol, commonly known as triclosan, is a synthetic organic compound characterized by its chlorinated phenolic structure. It is primarily recognized for its antibacterial and antifungal properties, making it a popular ingredient in various personal care products, household items, and industrial applications. The compound exhibits a high degree of lipophilicity, which allows it to effectively penetrate biological membranes. Its mechanism of action involves the inhibition of bacterial fatty acid synthesis, disrupting cell membrane integrity. Triclosan is stable under normal conditions but can degrade under UV light or in the presence of certain environmental factors. While it has been widely used, concerns regarding its environmental persistence and potential effects on human health and ecosystems have led to regulatory scrutiny and restrictions in some regions. As a result, its usage in consumer products has been decreasing, prompting the search for alternative antimicrobial agents. Overall, 4,5,6-Trichloro-2-(2,4-dichlorophenoxy)phenol remains a significant compound in discussions surrounding antimicrobial efficacy and environmental safety.
Formula:C12H5Cl5O2
InChI:InChI=1S/C12H5Cl5O2/c13-5-1-2-8(6(14)3-5)19-9-4-7(15)10(16)11(17)12(9)18/h1-4,18H
InChI key:InChIKey=PVLWIBDPWVHDIN-UHFFFAOYSA-N
SMILES:O(C1=C(O)C(Cl)=C(Cl)C(Cl)=C1)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- 2-(2,4-Dichlorophenoxy)-4,5,6-trichlorophenol
- 2′,3,4,4′,5-Pentachloro-2-hydroxydiphenyl ether
- 4,5,6-Trichloro-2-(2,4-dichlorophenoxy)phenol
- Phenol, 2,3,4-Trichloro-6-(2,4-Dichlorophenoxy)-
- 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,3,4-Trichloro-6-(2,4-dichlorophenoxy)phenol
CAS:Controlled ProductFormula:C12H5Cl5O2Color and Shape:NeatMolecular weight:358.4322,3,4-Trichloro-6-(2,4-dichlorophenoxy)phenol
CAS:<p>2,3,4-Trichloro-6-(2,4-dichlorophenoxy)phenol is a potent tumor inhibitor that has been shown to be effective against various types of cancer cells. It works by inhibiting the activity of certain proteins in the cell that are essential for cancer cell growth and survival. This compound has been tested on different cancer cell lines and has demonstrated apoptosis-inducing properties. In addition to its anticancer effects, 2,3,4-Trichloro-6-(2,4-dichlorophenoxy)phenol has also been found to have vitamin-like properties and is commonly found in Chinese urine as a natural anticancer agent. It regulates the cell cycle and plays an important role in preventing the growth and spread of cancer cells. Overall, this compound shows great potential as a therapeutic agent for the treatment of various types of cancer.</p>Formula:C12H5Cl5O2Purity:Min. 95%Molecular weight:358.4 g/mol

