CAS 53555-63-8
:1,2,3,5-tetrachloronaphthalene
Description:
1,2,3,5-Tetrachloronaphthalene is a chlorinated aromatic hydrocarbon characterized by the presence of four chlorine atoms attached to a naphthalene ring. This compound typically appears as a colorless to pale yellow solid and is known for its high stability and low volatility. It is insoluble in water but soluble in organic solvents, which makes it useful in various industrial applications, including as a chemical intermediate and in the production of specialty chemicals. The presence of multiple chlorine atoms enhances its chemical stability and resistance to degradation, but it also raises concerns regarding environmental persistence and potential toxicity. 1,2,3,5-Tetrachloronaphthalene may exhibit harmful effects on aquatic organisms and can bioaccumulate in the environment. As such, its use and disposal are subject to regulatory scrutiny. Safety precautions are necessary when handling this compound due to its potential health risks, including skin and respiratory irritation. Overall, while it serves specific industrial purposes, its environmental impact necessitates careful management.
Formula:C10H4Cl4
InChI:InChI=1/C10H4Cl4/c11-7-3-1-2-5-6(7)4-8(12)10(14)9(5)13/h1-4H
SMILES:c1cc2c(cc(c(c2Cl)Cl)Cl)c(c1)Cl
Synonyms:- Naphthalene, 1,2,3,5-tetrachloro
- 1,2,3,5-Tetrachloronaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
