CAS 53555-65-0
:1,2,3,5,7-pentachloronaphthalene
Description:
1,2,3,5,7-Pentachloronaphthalene is a chlorinated aromatic compound characterized by the presence of five chlorine atoms attached to a naphthalene ring. This compound typically appears as a solid with a high melting point and is insoluble in water but soluble in organic solvents. Its structure contributes to its stability and persistence in the environment, making it a subject of concern regarding environmental pollution and toxicity. 1,2,3,5,7-Pentachloronaphthalene is known for its potential bioaccumulation in aquatic organisms and may pose risks to human health and ecosystems. It has been studied for its effects on endocrine disruption and other toxicological impacts. Due to its chemical properties, it is often classified under persistent organic pollutants (POPs), leading to regulatory scrutiny and efforts to limit its use and release into the environment. Proper handling and disposal are essential to mitigate its environmental impact.
Formula:C10H3Cl5
InChI:InChI=1/C10H3Cl5/c11-4-1-6-5(7(12)2-4)3-8(13)10(15)9(6)14/h1-3H
SMILES:c1c(cc(c2cc(c(c(c12)Cl)Cl)Cl)Cl)Cl
Synonyms:- Naphthalene, 1,2,3,5,7-pentachloro
- 1,2,3,5,7-Pentachloronaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
