CAS 5356-83-2: Vinyldimethylethoxysilane
Description:Vinyldimethylethoxysilane, with the CAS number 5356-83-2, is an organosilicon compound characterized by its vinyl and ethoxy functional groups. This compound typically appears as a clear, colorless liquid and is known for its reactivity due to the presence of the vinyl group, which can participate in various polymerization reactions. It is commonly used as a coupling agent or a silane modifier in the production of silicone polymers and coatings, enhancing adhesion and improving the mechanical properties of materials. Vinyldimethylethoxysilane exhibits good thermal stability and resistance to moisture, making it suitable for applications in sealants, adhesives, and surface treatments. Additionally, it can be utilized in the synthesis of hybrid organic-inorganic materials, contributing to the development of advanced composites. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes. Overall, its unique chemical structure and properties make it valuable in various industrial applications.
Formula:C6H14OSi
InChI:InChI=1S/C6H14OSi/c1-5-7-8(3,4)6-2/h6H,2,5H2,1,3-4H3
InChI key:InChIKey=JEWCZPTVOYXPGG-UHFFFAOYSA-N
SMILES:O(CC)[Si](C=C)(C)C
- Synonyms:
- Dimethyl(ethenyl)silyloxyethane
- Dimethyl(vinyl)silyl ethyl ether
- Dimethyl-Vinyl-Ethoxysilane
- Dimethylethoxyvinylsilane
- Dimethylvinylethoxysilane
- Ethenyl(ethoxy)dimethylsilane
- Ethenylethoxydimethyl-Silan
- Ethenylethoxydimethylsilane
- Ethoxydimethylvinylsilane
- Ethoxyvinyldimethylsilane
- See more synonyms
- NSC 8963
- Silane, ethenylethoxydimethyl-
- Silane, ethoxydimethylvinyl-
- V 0046
- Vinyl dimethyl ethoxy silane
- Vinyldimethylethoxysilane
- ethenylethoxydimethyl-Silane
