CAS 53566-98-6
:2-(2-Aminopropoxy)-3-methylbenzenemethanol
Description:
2-(2-Aminopropoxy)-3-methylbenzenemethanol, with the CAS number 53566-98-6, is an organic compound characterized by its complex structure that includes an amino group, a propoxy group, and a hydroxymethyl group attached to a methyl-substituted aromatic ring. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The amino group can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Additionally, the presence of the aromatic ring contributes to its stability and may impart specific electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound's molecular structure suggests it may exhibit biological activity, although specific biological properties would depend on further empirical studies. Overall, 2-(2-Aminopropoxy)-3-methylbenzenemethanol represents a versatile chemical entity with potential utility in synthetic organic chemistry and medicinal chemistry.
Formula:C11H17NO2
InChI:InChI=1S/C11H17NO2/c1-8-4-3-5-10(6-13)11(8)14-7-9(2)12/h3-5,9,13H,6-7,12H2,1-2H3
InChI key:InChIKey=XMJYSMLLWRQQAE-UHFFFAOYSA-N
SMILES:O(CC(C)N)C1=C(CO)C=CC=C1C
Synonyms:- 2-(2-Aminopropoxy)-3-methylbenzenemethanol
- Benzenemethanol, 2-(2-aminopropoxy)-3-methyl-
- Ko 2259
- [2-(2-Aminopropoxy)-3-methylphenyl]methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Hydroxymethylmexiletine
CAS:Controlled ProductFormula:C11H17NO2Color and Shape:NeatMolecular weight:195.258
