CymitQuimica logo

CAS 53572-98-8

:

Imidazo[2,1-b][1,3]thiazole-6-carboxylic acid

Description:
Imidazo[2,1-b][1,3]thiazole-6-carboxylic acid is a heterocyclic compound characterized by its fused imidazole and thiazole rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, enhancing its acidity and making it soluble in polar solvents. The presence of nitrogen and sulfur atoms in its structure imparts distinct electronic properties, influencing its reactivity and potential biological activity. It is often studied for its applications in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals due to its ability to interact with biological targets. The compound may exhibit various biological activities, including antimicrobial and anticancer properties, making it of interest in drug discovery. Additionally, its structural characteristics allow for potential modifications that can enhance its efficacy or selectivity. Overall, Imidazo[2,1-b][1,3]thiazole-6-carboxylic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C6H3N2O2S
InChI:InChI=1/C6H4N2O2S/c9-5(10)4-3-8-1-2-11-6(8)7-4/h1-3H,(H,9,10)/p-1
InChI key:BAKIBSRDBASFAQ-UHFFFAOYSA-N
SMILES:c1csc2nc(cn12)C(=O)[O-]
Synonyms:
  • Imidazo[2,1-B]Thiazole-6-Carboxylic Acid
  • Imidazo[2,1-B][1,3]Thiazole-6-Carboxylate
Found 4 products.