CAS 53574-58-6

5-Formyl-2-pyridinecarboxylic acid

Description:

5-Formyl-2-pyridinecarboxylic acid, also known as nicotinic acid aldehyde, is an organic compound characterized by its pyridine ring structure, which features both an aldehyde and a carboxylic acid functional group. This compound has a molecular formula that reflects its dual functional nature, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. It typically appears as a solid or crystalline substance, exhibiting solubility in polar solvents such as water and alcohols due to the presence of the carboxylic acid group. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as a building block for more complex molecules. Its reactivity can be attributed to the electrophilic nature of the aldehyde group and the acidic properties of the carboxylic acid, making it suitable for various chemical transformations. Additionally, the presence of the pyridine ring may impart unique electronic properties, influencing its behavior in chemical reactions and interactions with biological systems.

Formula: C₇H₅NO₃

InChI: InChI=1S/C7H5NO3/c9-4-5-1-2-6(7(10)11)8-3-5/h1-4H,(H,10,11)

InChI key: InChIKey=HBNWKIVJXHRLQM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=C(C=O)C=N1

Synonyms:

• 2-Pyridinecarboxylic acid, 5-formyl-
• 5-Formylpyridine-2-carboxylic acid
• 5-Formyl-2-pyridinecarboxylic acid

2-Pyridinecarboxylicacid,5-formyl-(9CI)

CAS: 53574-58-6

Formula: C₇H₅NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 151.1195

Ref: IN-DA00DLGB

5-Formylpicolinic acid

CAS: 53574-58-6

5-Formylpicolinic acid

Purity: 96%

Molecular weight: 151.12g/mol

Ref: 54-OR78468

5-Formylpicolinic acid

CAS: 53574-58-6

Purity: 96%

Molecular weight: 151.1210022

Ref: 10-F904237

5-formylpyridine-2-carboxylic acid

CAS: 53574-58-6

Versatile small molecule scaffold

Formula: C₇H₅NO₃

Purity: Min. 95%

Molecular weight: 151.1 g/mol

Ref: 3D-DCA57458