CAS 53578-15-7
:Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1-carboxylic acid
Description:
Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1-carboxylic acid, with the CAS number 53578-15-7, is a polycyclic compound characterized by its unique fused ring structure. This compound features five interconnected cycloalkane rings, which contribute to its rigidity and stability. The presence of a carboxylic acid functional group at the 1-position of the pentacyclic framework imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The compound is typically insoluble in water due to its hydrophobic nature, but it may dissolve in organic solvents. Its structural complexity makes it of interest in organic synthesis and materials science, particularly in the development of novel polymers and drug delivery systems. Additionally, the unique arrangement of carbon atoms may influence its reactivity and interaction with biological systems, making it a subject of study in medicinal chemistry. Overall, pentacyclo[4.2.0.02,5.03,8.04,7]octane-1-carboxylic acid exemplifies the intriguing properties of polycyclic compounds in chemistry.
Formula:C9H8O2
InChI:InChI=1S/C9H8O2/c10-8(11)9-5-2-1-3(5)7(9)4(1)6(2)9/h1-7H,(H,10,11)
InChI key:InChIKey=NVBIDTXRBMYRGD-UHFFFAOYSA-N
SMILES:C(O)(=O)C12C3C4C1C5C2C3C45
Synonyms:- Pentacyclo[4.2.0.02,5.03,8.04,7]octanecarboxylic acid
- Cubanecarboxylic acid
- 1-Carboxycubane
- 1-Cubanecarboxylic acid
- Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1-carboxylic acid
- Pentacyclo[4.2.0.02,5.03,8.04,7]octanecarboxylic acid (7CI,9CI)
- rboxylic acid
- cubane-1-carboxylic acid - [C24129]
- 5.03,8.04,7]octaneca
- (2R,3R,5R,6R,7R,8R)-Cubane-1-carboxylic acid
- cubane-1-carboxylic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2r,3r,5r,6r,7r,8r)-Cubane-1-carboxylic Acid
CAS:Formula:C9H8O2Purity:>98.0%(GC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:148.16(2R,3R,5R,6R,7R,8R)-Cubane-1-carboxylic acid
CAS:(2R,3R,5R,6R,7R,8R)-Cubane-1-carboxylic acidPurity:97%Color and Shape:PowderMolecular weight:148.16g/mol(2r,3r,5r,6r,7r,8r)-cubane-1-carboxylic acid
CAS:Formula:C9H8O2Purity:95%Color and Shape:SolidMolecular weight:148.161Cubane-1-carboxylic acid
CAS:Cubane-1-carboxylic acid is a molecule that is used in organic chemistry. It has four functional groups, which are the methyl ketones and carboxylate ester. Cubane-1-carboxylic acid has been shown to be an efficient method for the synthesis of methyl ketones and carboxylates through cross-coupling reactions with organometallic reagents. Cubane-1-carboxylic acid can also be used as a substrate for methane monooxygenase, which is an enzyme that catalyzes a step in the conversion of methane to methanol. Cubane-1-carboxylic acid has also been shown to inhibit influenza virus activity by binding to viral RNA polymerase, preventing transcription and replication of viral mRNA.Formula:C9H8O2Purity:Min. 95%Molecular weight:148.16 g/mol




