CAS 53580-21-5

4,4,5,5,6,6,6-Heptafluoro-1-phenyl-1,3-hexanedione

Description:

4,4,5,5,6,6,6-Heptafluoro-1-phenyl-1,3-hexanedione, with CAS number 53580-21-5, is a fluorinated organic compound characterized by its unique structure that includes multiple fluorine atoms and a phenyl group. This compound typically exhibits high thermal stability and low volatility due to the presence of fluorine, which enhances its chemical resilience. It is often used in various applications, including as a reagent in organic synthesis and in the development of fluorinated materials. The presence of the phenyl group contributes to its aromatic characteristics, potentially influencing its solubility and reactivity. Additionally, the heptafluoro substituents can impart unique properties such as increased hydrophobicity and altered electronic characteristics, making it useful in specialized chemical processes. Safety considerations are important when handling this compound, as fluorinated compounds can exhibit toxicity and environmental persistence. Overall, 4,4,5,5,6,6,6-Heptafluoro-1-phenyl-1,3-hexanedione is notable for its distinctive chemical properties and potential applications in advanced materials and synthesis.

Formula: C₁₂H₇F₇O₂

InChI: InChI=1/C12H7F7O2/c13-10(14,11(15,16)12(17,18)19)9(21)6-8(20)7-4-2-1-3-5-7/h1-5H,6H2

SMILES: c1ccc(cc1)C(=O)CC(=O)C(C(C(F)(F)F)(F)F)(F)F

Synonyms:

• 4,4,5,5,6,6,6-Heptafluoro-1-Phenylhexane-1,3-Dione

1-Phenyl-2H,2H-perfluorohexane-1,3-dione

CAS: 53580-21-5

1-Phenyl-2H,2H-perfluorohexane-1,3-dione

Purity: ≥95%

Molecular weight: 316.17g/mol

Ref: 54-PC10027