CAS 53585-53-8: Benzene, bis(phenylmethyl)-, ar-methyl deriv.

Description:Benzene, bis(phenylmethyl)-, ar-methyl deriv., also known by its CAS number 53585-53-8, is an organic compound characterized by its structure, which features a central benzene ring substituted with two phenylmethyl groups and an additional methyl group. This compound belongs to the class of aromatic hydrocarbons, exhibiting properties typical of such compounds, including stability due to resonance and a relatively low reactivity compared to aliphatic compounds. It is generally non-polar and insoluble in water, but soluble in organic solvents. The presence of multiple aromatic rings contributes to its potential applications in various fields, including materials science and organic synthesis. Additionally, its chemical behavior can be influenced by the substituents on the benzene ring, affecting its reactivity and interaction with other chemical species. Safety data should be consulted for handling and exposure guidelines, as with many aromatic compounds, there may be health and environmental considerations associated with its use.

Formula:C₂₁H₂₀

InChI:InChI=1/C21H20/c1-17-9-8-14-20(15-18-10-4-2-5-11-18)21(17)16-19-12-6-3-7-13-19/h2-14H,15-16H2,1H3