
CAS 53587-44-3
:Melamine borate
Description:
Melamine borate is an inorganic compound that combines melamine, a nitrogen-rich organic compound, with boric acid. It is primarily recognized for its flame-retardant properties, making it valuable in various applications, particularly in plastics, textiles, and coatings. The compound exhibits a white crystalline appearance and is soluble in water, which enhances its utility in formulations where moisture resistance is required. Melamine borate functions by releasing water vapor when exposed to heat, thereby cooling the material and diluting flammable gases. Additionally, it can improve the mechanical properties of materials, contributing to their durability and stability. The compound is considered non-toxic and environmentally friendly, aligning with increasing demands for safer chemical alternatives in industrial applications. Its effectiveness as a flame retardant is often evaluated in conjunction with other additives to optimize performance in specific formulations. Overall, melamine borate serves as a multifunctional additive that enhances both safety and material properties in various industries.
Formula:C3H6N6·xBH3O3
InChI:InChI=1S/C3H6N6.BH3O3/c4-1-7-2(5)9-3(6)8-1;2-1(3)4/h(H6,4,5,6,7,8,9);2-4H
InChI key:InChIKey=IUTYMBRQELGIRS-UHFFFAOYSA-N
SMILES:B(O)(O)O.NC=1N=C(N)N=C(N)N1
Synonyms:- Budit 313
- Boric acid (H3BO3), compd. with 1,3,5-triazine-2,4,6-triamine (1:?)
- Melamine borate
- 1,3,5-Triazine-2,4,6-triamine, compd. with boric acid (H3BO3)
- Boric acid (H3BO3), compd. with 1,3,5-triazine-2,4,6-triamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
orthoboric acid, compound with 1,3,5-triazine-2,4,6-triamine
CAS:Formula:C3H9Bn6O3Molecular weight:187.9530 G/Mol

