CAS 535934-25-9

1-Bromo-2-chloro-4-iodobenzene

Description:

1-Bromo-2-chloro-4-iodobenzene is an organic compound characterized by the presence of three halogen substituents on a benzene ring. Specifically, it features a bromine atom at the first position, a chlorine atom at the second position, and an iodine atom at the fourth position of the aromatic ring. This compound is typically a solid at room temperature and is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of multiple halogens can influence its reactivity, making it a useful intermediate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions. Additionally, the differing electronegativities of the halogens can affect the compound's polarity and solubility in various solvents. Safety precautions should be observed when handling this compound, as halogenated compounds can pose health risks and environmental concerns. Overall, 1-Bromo-2-chloro-4-iodobenzene is a significant compound in the field of synthetic organic chemistry.

Formula: C₆H₃BrClI

InChI: InChI=1/C6H3BrClI/c7-5-2-1-4(9)3-6(5)8/h1-3H

SMILES: c1cc(c(cc1I)Cl)Br

Synonyms:

• Benzene, 1-bromo-2-chloro-4-iodo-
• 4-Bromo-3-Chloroiodobenzene

4-Bromo-3-chloroiodobenzene

CAS: 535934-25-9

Formula: C₆H₃BrClI

Purity: 97%

Color and Shape: Solid

Molecular weight: 317.3495

Ref: IN-DA00DBSR

1-Bromo-2-chloro-4-iodobenzene

CAS: 535934-25-9

Formula: C₆H₃BrClI

Purity: >98.0%(GC)

Color and Shape: White or Colorless to Light yellow to Light orange powder to lump to clear liquid

Molecular weight: 317.35

Ref: 3B-B5742

4-Bromo-3-chloroiodobenzene

CAS: 535934-25-9

4-Bromo-3-chloroiodobenzene

Formula: C₆H₃BrClI

Purity: 98%

Color and Shape: faint beige to brown solid

Molecular weight: 317.35g/mol

Ref: 54-OR400630

4-Bromo-3-chloroiodobenzene

CAS: 535934-25-9

Formula: C₆H₃BrClI

Purity: 97.0%

Color and Shape: Low Melting Solid

Molecular weight: 317.35

Ref: 10-F021409