CAS 535961-78-5

2-fluoro-6-methyl-benzoyl chloride

Description:

2-Fluoro-6-methyl-benzoyl chloride is an aromatic compound characterized by the presence of a benzoyl chloride functional group, which consists of a carbonyl group (C=O) attached to a benzene ring, along with a fluorine atom and a methyl group at specific positions on the ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which can undergo nucleophilic substitution reactions. The fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and influencing its interactions with other chemical species. 2-Fluoro-6-methyl-benzoyl chloride is often used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Safety precautions are necessary when handling this compound, as it can be corrosive and may release harmful gases upon contact with water or moisture.

Formula: C₈H₆ClFO

InChI: InChI=1/C8H6ClFO/c1-5-3-2-4-6(10)7(5)8(9)11/h2-4H,1H3

SMILES: Cc1cccc(c1C(=O)Cl)F

Synonyms:

• 2-Fluor-6-methyl benzoyl chloride
• Benzoyl Chloride, 2-Fluoro-6-Methyl-

Benzoyl chloride, 2-fluoro-6-methyl- (9CI)

CAS: 535961-78-5

Formula: C₈H₆ClFO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 172.5840

Ref: IN-DA00D8YL

2-Fluoro-6-methylbenzoyl chloride

CAS: 535961-78-5

2-Fluoro-6-methylbenzoyl chloride

Formula: C₈H₆ClFO

Purity: 98%

Color and Shape: purple liquid

Molecular weight: 172.58g/mol

Ref: 54-PC905471

2-Fluoro-6-methylbenzoyl chloride

CAS: 535961-78-5

Formula: C₈H₆ClFO

Purity: 97%

Color and Shape: Liquid, Clear

Molecular weight: 172.58

Ref: 10-F062681