CAS 53602-74-7
:(2S)-2-[acetyl(nitroso)amino]-3-(1H-indol-3-yl)propanoic acid
Description:
The chemical substance known as (2S)-2-[acetyl(nitroso)amino]-3-(1H-indol-3-yl)propanoic acid, with the CAS number 53602-74-7, is an organic compound that features a complex structure incorporating an indole moiety, an acetyl group, and a nitroso functional group. This compound is characterized by its chiral center at the second carbon, which contributes to its stereochemistry. The presence of the indole ring suggests potential biological activity, as indole derivatives are often found in various natural products and pharmaceuticals. The acetyl and nitroso groups can influence the compound's reactivity and solubility, potentially affecting its interactions in biological systems. Additionally, the propanoic acid component indicates that the substance is likely to exhibit acidic properties. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry and biochemistry research. However, detailed studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C13H13N3O4
InChI:InChI=1/C13H13N3O4/c1-8(17)16(15-20)12(13(18)19)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,12,14H,6H2,1H3,(H,18,19)/t12-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

