CAS 53623-80-6

2-(2,2,2-Trifluoro-1-phenylethoxy)acetic acid

Description:

2-(2,2,2-Trifluoro-1-phenylethoxy)acetic acid, with the CAS number 53623-80-6, is a chemical compound characterized by its unique structure that includes a trifluoromethyl group and an ether linkage. This compound typically exhibits properties associated with both acidic and ether functionalities, making it a versatile molecule in organic synthesis. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. As an acetic acid derivative, it can participate in various chemical reactions, including esterification and nucleophilic substitution. The compound may also exhibit interesting pharmacological properties, which can be attributed to the phenyl and trifluoromethyl substituents. Its solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals are noteworthy. However, specific handling precautions should be observed due to the presence of fluorinated groups, which can affect environmental persistence and toxicity. Overall, this compound represents a significant interest in both synthetic chemistry and potential applications in various fields.

Formula: C₁₀H₉F₃O₃

InChI: InChI=1S/C10H9F3O3/c11-10(12,13)9(16-6-8(14)15)7-4-2-1-3-5-7/h1-5,9H,6H2,(H,14,15)

InChI key: InChIKey=QVFVPBIDJMYUDX-UHFFFAOYSA-N

SMILES: C(OCC(O)=O)(C(F)(F)F)C1=CC=CC=C1

Synonyms:

• Acetic acid, 2-(2,2,2-trifluoro-1-phenylethoxy)-
• 2-(2,2,2-Trifluoro-1-phenylethoxy)acetic acid
• Acetic acid, (2,2,2-trifluoro-1-phenylethoxy)-

(2,2,2-trifluoro-1-phenylethoxy)acetic acid

CAS: 53623-80-6

Formula: C₁₀H₉F₃O₃

Purity: 95.0%

Molecular weight: 234.174

Ref: 10-F313922