CAS 53625-15-3
:(3R,5S,5a'R,7'R,8a'R)-5-(furan-3-yl)-7'-methyl-3',4,5,5',5a',7',8',8a'-octahydrospiro[furan-3,6'-naphtho[1,8-bc]furan]-2,2'(4'H)-dione
Description:
The chemical substance with the name "(3R,5S,5a'R,7'R,8a'R)-5-(furan-3-yl)-7'-methyl-3',4,5,5',5a',7',8',8a'-octahydrospiro[furan-3,6'-naphtho[1,8-bc]furan]-2,2'(4'H)-dione" and CAS number "53625-15-3" is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both furan and naphthoquinone moieties. This compound features multiple stereocenters, indicating that it exists in specific stereoisomeric forms, which can significantly influence its chemical behavior and biological activity. The presence of the furan ring suggests potential reactivity, particularly in electrophilic substitution reactions, while the naphthoquinone structure may contribute to its redox properties. Additionally, the compound's octahydro configuration implies a saturated framework, which can affect its solubility and interaction with biological systems. Overall, this substance may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and related fields.
Formula:C19H20O5
InChI:InChI=1/C19H20O5/c1-10-7-14-16-12(17(20)23-14)3-2-4-13(16)19(10)8-15(24-18(19)21)11-5-6-22-9-11/h5-6,9-10,13-15H,2-4,7-8H2,1H3/t10-,13-,14-,15+,19-/m1/s1
Synonyms:- Teucvidin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Teucvidin
CAS:Teucvidin is a natural diterpene suitable for biochemical experiments and drug synthesis research.Formula:C19H20O5Purity:99.90%Color and Shape:SolidMolecular weight:328.36Teucvin
CAS:Teucvin is a synthetic compound, which is derived from advanced organic synthesis techniques and is intended for biological research purposes. This compound functions primarily through a specific modulation of certain cellular receptors, allowing for targeted interaction with biological pathways involved in disease states or cellular processes. The mode of action involves binding to targeted receptors, which can alter pathways and provide insights into biochemical mechanisms.
Formula:C19H20O5Purity:Min. 95%Molecular weight:328.4 g/mol


