CAS 53627-36-4
:4-ethenyldihydrofuran-2(3H)-one
Description:
4-Ethenyldihydrofuran-2(3H)-one, also known by its CAS number 53627-36-4, is a chemical compound characterized by its unique structure, which includes a furan ring and an enone functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the double bond in the ethenyl group and the carbonyl group in the lactone structure. It is soluble in organic solvents and may exhibit moderate stability under standard conditions. The compound is of interest in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity allows it to participate in various chemical reactions, including polymerization and cycloaddition. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose risks such as irritation or toxicity. Overall, 4-ethenyldihydrofuran-2(3H)-one is a versatile compound with potential applications in synthetic chemistry.
Formula:C6H8O2
InChI:InChI=1/C6H8O2/c1-2-5-3-6(7)8-4-5/h2,5H,1,3-4H2
SMILES:C=CC1CC(=O)OC1
Synonyms:- 2(3H)-furanone, 4-ethenyldihydro-
- 4-Vinyldihydrofuran-2(3H)-on
- 4-vinyldihydrofuran-2(3H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-vinyl-dihydrofuran-2(3H)-one
CAS:Formula:C6H8O2Purity:98%Color and Shape:LiquidMolecular weight:112.12654-Vinyl-dihydrofuran-2(3H)-one
CAS:4-Vinyl-dihydrofuran-2(3H)-onePurity:98%Molecular weight:112.13g/mol4-VINYLDIHYDROFURAN-2(3H)-ONE
CAS:Formula:C6H8O2Purity:98% (stabilized with TBC)Molecular weight:112.1284-Vinyl-dihydrofuran-2(3H)-one
CAS:4-Vinyl-dihydrofuran-2(3H)-one is a cyclopropanecarboxylic acid that can be synthesized using the refluxing of an alkali metal hydroxide, such as potassium hydroxide, with an alcohol. The reaction produces a cyclopropanecarboxylic acid and water. 4-Vinyl-dihydrofuran-2(3H)-one is used as an insecticide as well as in the synthesis of other chemicals. It has been shown to have anticholinesterase activity.Formula:C6H8O2Purity:Min. 95%Molecular weight:112.13 g/mol



