CAS 5365-14-0

2,2-Dichlorocyclopropane-1-carboxylic acid

Description:

2,2-Dichlorocyclopropane-1-carboxylic acid is a chemical compound characterized by its cyclopropane ring structure, which is substituted with two chlorine atoms at the 2-position and a carboxylic acid functional group at the 1-position. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its reactivity due to the presence of the carboxylic acid group, which can participate in various chemical reactions, including esterification and decarboxylation. The dichloro substituents contribute to its potential as an intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound's unique structure may impart specific physical properties, such as boiling and melting points, which are influenced by the steric effects of the chlorine atoms. Safety considerations are important when handling this compound, as it may pose health risks, and appropriate precautions should be taken to mitigate exposure.

Formula: C₄H₄Cl₂O₂

InChI: InChI=1/C4H4Cl2O2/c5-4(6)1-2(4)3(7)8/h2H,1H2,(H,7,8)

SMILES: C1C(C(=O)O)C1(Cl)Cl

Synonyms:

• (1S)-2,2-dichlorocyclopropanecarboxylate
• (1R)-2,2-dichlorocyclopropanecarboxylate
• 2,2-Dichlorocyclopropanecarboxylic Acid

2,2-dichlorocyclopropane-1-carboxylic acid

CAS: 5365-14-0

2,2-dichlorocyclopropane-1-carboxylic acid

Purity: 98%

Molecular weight: 154.98g/mol

Ref: 54-OR27835

2,2-Dichlorocyclopropane-1-carboxylic acid

CAS: 5365-14-0

Purity: 98%

Molecular weight: 154.9700012

Ref: 10-F718031

2,2-Dichlorocyclopropane-1-carboxylic acid

CAS: 5365-14-0

2,2-Dichlorocyclopropane-1-carboxylic acid is a chemical substance that belongs to the group of fungicides. It is used as an acceptor in organic synthesis and as a dehydrative agent. 2,2-Dichlorocyclopropane-1-carboxylic acid has bactericidal effects on some bacteria species and is active against fungi. The compound can be prepared by reacting chloroacetic acid with cyclopropanecarboxylic acid or by the reaction of 2,2,2-trichloroethanol with cyclopropanecarboxylic acid. 2,2-Dichlorocyclopropane-1-carboxylic acid can be used as an enantiomer to synthesize other compounds. This compound has two resonance forms which are related to its carboxylic group and its optically active form.

Formula: C₄H₄Cl₂O₂

Purity: Min. 95%

Molecular weight: 154.98 g/mol

Ref: 3D-FAA36514