CAS 5365-25-3

2,2-Dichlorocyclopropaneacetonitrile

Description:

2,2-Dichlorocyclopropaneacetonitrile, with the CAS number 5365-25-3, is a chemical compound characterized by its unique structure, which includes a cyclopropane ring substituted with two chlorine atoms and an acetonitrile functional group. This compound is typically a colorless to pale yellow liquid, exhibiting a relatively low boiling point and moderate solubility in organic solvents. Its molecular structure contributes to its reactivity, particularly in nucleophilic substitution reactions, making it useful in various synthetic applications. The presence of chlorine atoms enhances its electrophilic character, allowing it to participate in further chemical transformations. Additionally, 2,2-Dichlorocyclopropaneacetonitrile may exhibit toxicity, necessitating careful handling and appropriate safety measures during use. Its applications can span across fields such as agrochemicals, pharmaceuticals, and materials science, where it may serve as an intermediate in the synthesis of more complex molecules. As with all chemical substances, understanding its properties and potential hazards is crucial for safe and effective utilization.

Formula: C₅H₅Cl₂N

InChI: InChI=1S/C5H5Cl2N/c6-5(7)3-4(5)1-2-8/h4H,1,3H2

InChI key: InChIKey=METYSMJJRFRDPP-UHFFFAOYSA-N

SMILES: C(C#N)C1C(Cl)(Cl)C1

Synonyms:

• 2,2-Dichlorocyclopropaneacetonitrile
• Cyclopropaneacetonitrile, 2,2-dichloro-
• 1,1-Dichloro-2-cyanomethylcyclopropane
• 2-(2,2-Dichlorocyclopropyl)acetonitrile

2-(2,2-Dichlorocyclopropyl)acetonitrile

CAS: 5365-25-3

2-(2,2-Dichlorocyclopropyl)acetonitrile is a polyatomic molecule that is often used in the synthesis of other compounds. It has been shown to react with sodium cyanide to form a compound called covid-19, which is then reacted with piperidine and thiophenol to form polyatomic molecules. Covid-19 is also the active ingredient in a vaccine that was developed as a response to the pandemic of H1N1 influenza. This drug has been shown to be effective against influenza A strains and other flu viruses, including avian flu.

Formula: C₅H₅Cl₂N

Purity: Min. 95%

Molecular weight: 150 g/mol

Ref: 3D-FAA36525