CAS 53654-12-9

4-(4-Morpholinyl)-4-piperidinecarboxamide

Description:

4-(4-Morpholinyl)-4-piperidinecarboxamide, with the CAS number 53654-12-9, is a chemical compound characterized by its unique structure that includes a piperidine ring and a morpholine moiety. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents due to the presence of amide and morpholine functional groups. It is often studied for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for drug development. The presence of both the morpholine and piperidine rings suggests potential interactions with biological targets, making it of interest in pharmacological research. Additionally, the compound may exhibit specific reactivity patterns typical of amides, such as undergoing hydrolysis under certain conditions. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, 4-(4-Morpholinyl)-4-piperidinecarboxamide represents a versatile compound with potential applications in various fields, particularly in the development of therapeutic agents.

Formula: C₁₀H₁₉N₃O₂

InChI: InChI=1S/C10H19N3O2/c11-9(14)10(1-3-12-4-2-10)13-5-7-15-8-6-13/h12H,1-8H2,(H2,11,14)

InChI key: InChIKey=OEDOITYEASREQH-UHFFFAOYSA-N

SMILES: C(N)(=O)C1(CCNCC1)N2CCOCC2

Synonyms:

• 4-(4-Morpholinyl)-4-piperidinecarboxamide
• 4-Carbamoyl-4-morpholinopiperidine
• 4-Morpholin-4-Ylpiperidine-4-Carboxamide
• 4-Piperidinecarboxamide, 4-(4-morpholinyl)-
• Isonipecotamide, 4-morpholino-
• 4-Morpholinopiperidine-4-carboxamide