CAS 53658-17-6

(2-hydroxyphenyl)(1,2-oxazol-4-yl)methanone

Description:

(2-hydroxyphenyl)(1,2-oxazol-4-yl)methanone, also known by its CAS number 53658-17-6, is an organic compound characterized by the presence of a phenolic hydroxyl group and an oxazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents and influencing its interaction with biological systems. The oxazole moiety introduces heteroatoms into the structure, which can affect electronic properties and reactivity. This compound may exhibit fluorescence, making it useful in various applications, including as a fluorescent probe or in materials science. Additionally, its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Overall, the unique combination of functional groups in (2-hydroxyphenyl)(1,2-oxazol-4-yl)methanone contributes to its diverse chemical behavior and potential utility in various fields.

Formula: C₁₀H₇NO₃

InChI: InChI=1/C10H7NO3/c12-9-4-2-1-3-8(9)10(13)7-5-11-14-6-7/h1-6,12H

SMILES: c1ccc(c(c1)C(=O)c1cnoc1)O

Synonyms:

• (2-Hydroxyphenyl)(Isoxazol-4-Yl)Methanone

2-(1,2-Oxazole-4-carbonyl)phenol

CAS: 53658-17-6

Versatile small molecule scaffold

Formula: C₁₀H₇NO₃

Purity: Min. 95%

Molecular weight: 189.17 g/mol

Ref: 3D-DCA65817