CAS 53666-48-1

N-(2-chloro-5-nitrophenyl)formamide

Description:

N-(2-chloro-5-nitrophenyl)formamide is an organic compound characterized by its functional groups, which include a formamide moiety and a substituted aromatic ring. The presence of a chlorine atom and a nitro group on the phenyl ring contributes to its chemical reactivity and polarity. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the formamide group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly as an intermediate in the synthesis of more complex molecules. The chlorine and nitro substituents can influence the compound's electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions or reductions. Safety data should be consulted, as compounds with halogen and nitro groups can exhibit toxicity or environmental hazards. Proper handling and disposal protocols are essential when working with this substance in a laboratory setting.

Formula: C₇H₅ClN₂O₃

InChI: InChI=1/C7H5ClN2O3/c8-6-2-1-5(10(12)13)3-7(6)9-4-11/h1-4H,(H,9,11)

SMILES: c1cc(c(cc1N(=O)=O)N=CO)Cl

Synonyms:

• formamide, N-(2-chloro-5-nitrophenyl)-

N-(2-Chloro-5-nitrophenyl)formamide

CAS: 53666-48-1

Versatile small molecule scaffold

Formula: C₇H₅ClN₂O₃

Purity: Min. 95%

Molecular weight: 200.58 g/mol

Ref: 3D-DCA66648