CAS 53671-71-9

N-[2-[3-(2-Cyanophenoxy)-2-hydroxypropylamino]ethyl]-N'-phenylurea

Description:

N-[2-[3-(2-Cyanophenoxy)-2-hydroxypropylamino]ethyl]-N'-phenylurea, with CAS number 53671-71-9, is a chemical compound characterized by its complex structure, which includes a urea functional group, an aromatic phenyl group, and a cyanophenoxy moiety. This compound typically exhibits properties associated with both hydrophilicity and lipophilicity due to the presence of hydroxyl and aromatic groups, allowing it to interact with various biological systems. It is often studied for its potential applications in pharmaceuticals, particularly in the development of therapeutic agents. The presence of the cyanophenoxy group may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by its molecular structure, which may affect its behavior in different environments. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity, necessitating thorough evaluation in laboratory settings.

Formula: C₁₉H₂₂N₄O₃

InChI: InChI=1/C19H22N4O3/c20-12-15-6-4-5-9-18(15)26-14-17(24)13-21-10-11-22-19(25)23-16-7-2-1-3-8-16/h1-9,17,21,24H,10-11,13-14H2,(H2,22,23,25)

SMILES: c1ccc(cc1)NC(=NCCNCC(COc1ccccc1C#N)O)O

Synonyms:

• Ici-89406
• 1-(2-{[3-(2-Cyanophenoxy)-2-Hydroxypropyl]Amino}Ethyl)-3-Phenylurea

Ici 89406

CAS: 53671-71-9

Formula: C₁₉H₂₂N₄O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 354.4030

Ref: IN-DA003QZC

ICI 89406

CAS: 53671-71-9

ICI 89406

Purity: ≥98%

Molecular weight: 354.4g/mol

Ref: 54-BUP08401

ICI 89406

CAS: 53671-71-9

ICI 89406 (1-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-3-phenylurea) is a β-adrenergic antagonist.

Formula: C₁₉H₂₂N₄O₃

Purity: 99.92%

Color and Shape: Solid

Molecular weight: 354.4

Ref: TM-T22852

ICI 89406

Controlled Product

CAS: 53671-71-9

Formula: C₁₉H₂₂N₄O₃

Color and Shape: Neat

Molecular weight: 354.403

Ref: TR-I163890

ICI 89406

CAS: 53671-71-9

ICI 89406 is an analytical agent that binds to the 2-adrenergic receptor. Binding of ICI 89406 to this receptor leads to a reduction in the levels of cAMP and activation of protein kinase A, which regulates glucose uptake, thermogenesis, and cardiac function. ICI 89406 has also been shown to bind to guanine nucleotide-binding proteins that regulate binding of GTP, thereby inhibiting transcription-polymerase chain reaction (PCR) activity. This drug has affinity constants for both the heart and adrenal gland tissues. It is selective for the 2-adrenergic receptor and does not bind to other receptors such as those for serotonin or dopamine.

Formula: C₁₉H₂₂N₄O₃

Purity: Min. 95%

Molecular weight: 354.41 g/mol

Ref: 3D-DCA67171