CAS 53676-22-5
:2,2,2-tribromoethyl dichlorophosphate
Description:
2,2,2-Tribromoethyl dichlorophosphate is an organophosphorus compound characterized by its unique structure, which includes a phosphorus atom bonded to two chlorine atoms and an ethyl group that is further substituted with three bromine atoms. This compound is typically used as a flame retardant and has applications in various industrial processes. It is known for its high density and potential toxicity, particularly due to the presence of bromine and chlorine, which can contribute to environmental and health concerns. The compound is generally stable under normal conditions but may decompose when exposed to heat or certain reactive agents. Safety precautions are essential when handling this substance, as it can pose risks through inhalation, skin contact, or ingestion. Proper storage and disposal methods are crucial to mitigate its environmental impact. Overall, 2,2,2-tribromoethyl dichlorophosphate exemplifies the complexities of organophosphorus chemistry, balancing utility with safety considerations.
Formula:C2H2Br3Cl2O2P
InChI:InChI=1/C2H2Br3Cl2O2P/c3-2(4,5)1-9-10(6,7)8/h1H2
SMILES:C(C(Br)(Br)Br)OP(=O)(Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2,2-Tribromoethyl Dichlorophosphate
CAS:Controlled Product<p>Applications 2,2,2-Tribromoethyl Dichlorophosphate is a reagent for the synthesis of aryl trihaloethyl dihydrogen phosphates.<br>References Owen, G. R., et al.: Synthesis, 10, 704 (1974)<br></p>Formula:C2H2Br3Cl2O2PColor and Shape:NeatMolecular weight:346.378
